C25H20BrN3O3S — CID 3839476
2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-butoxyanilino)prop-2-enenitrile (PubChem CID 3839476) has the molecular formula C25H20BrN3O3S and a molecular weight of 522.42 g/mol. Its IUPAC name is 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-butoxyanilino)prop-2-enenitrile.
| Compound Name | 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-butoxyanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 3839476 |
| Molecular Formula | C25H20BrN3O3S |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-butoxyanilino)prop-2-enenitrile |
| SMILES | CCCCOc1cccc(NC=C(C#N)c2nc(-c3cc4cc(Br)ccc4oc3=O)cs2)c1 |
| InChI | InChI=1S/C25H20BrN3O3S/c1-2-3-9-31-20-6-4-5-19(12-20)28-14-17(13-27)24-29-22(15-33-24)21-11-16-10-18(26)7-8-23(16)32-25(21)30/h4-8,10-12,14-15,28H,2-3,9H2,1H3 |
| InChIKey | XIFCPPKPGKHOTB-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|