C23H17N3O4S2 — CID 53451720
methyl 2-[[2-cyano-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]ethenyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 53451720) has the molecular formula C23H17N3O4S2 and a molecular weight of 463.54 g/mol. Its IUPAC name is methyl 2-[[2-cyano-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]ethenyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-cyano-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]ethenyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 53451720 |
| Molecular Formula | C23H17N3O4S2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | methyl 2-[[2-cyano-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]ethenyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC=C(C#N)c2nc(-c3cc4ccccc4oc3=O)cs2)sc(C)c1C |
| InChI | InChI=1S/C23H17N3O4S2/c1-12-13(2)32-21(19(12)23(28)29-3)25-10-15(9-24)20-26-17(11-31-20)16-8-14-6-4-5-7-18(14)30-22(16)27/h4-8,10-11,25H,1-3H3 |
| InChIKey | DVOORMDWFREVRI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|