C28H25N3O6S2 — CID 4916716
2-O-tert-butyl 4-O-ethyl 5-[[2-cyano-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]ethenyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 4916716) has the molecular formula C28H25N3O6S2 and a molecular weight of 563.66 g/mol. Its IUPAC name is 2-O-tert-butyl 4-O-ethyl 5-[[2-cyano-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]ethenyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | 2-O-tert-butyl 4-O-ethyl 5-[[2-cyano-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]ethenyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 4916716 |
| Molecular Formula | C28H25N3O6S2 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | 2-O-tert-butyl 4-O-ethyl 5-[[2-cyano-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]ethenyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC=C(C#N)c2nc(-c3cc4ccccc4oc3=O)cs2)sc(C(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C28H25N3O6S2/c1-6-35-26(33)21-15(2)22(27(34)37-28(3,4)5)39-24(21)30-13-17(12-29)23-31-19(14-38-23)18-11-16-9-7-8-10-20(16)36-25(18)32/h7-11,13-14,30H,6H2,1-5H3 |
| InChIKey | QIWRQOUFVCLPOJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|