C21H19N3O5S — CID 3478454
diethyl 5-[[2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 3478454) has the molecular formula C21H19N3O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is diethyl 5-[[2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3478454 |
| Molecular Formula | C21H19N3O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | diethyl 5-[[2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC=C(C#N)c2nc3ccccc3o2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C21H19N3O5S/c1-4-27-20(25)16-12(3)17(21(26)28-5-2)30-19(16)23-11-13(10-22)18-24-14-8-6-7-9-15(14)29-18/h6-9,11,23H,4-5H2,1-3H3 |
| InChIKey | CXBHCRVSWZCWOU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|