C26H25N3O4S2 — CID 3797117
4-O-ethyl 2-O-prop-2-enyl 5-[[2-cyano-2-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 3797117) has the molecular formula C26H25N3O4S2 and a molecular weight of 507.64 g/mol. Its IUPAC name is 4-O-ethyl 2-O-prop-2-enyl 5-[[2-cyano-2-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-prop-2-enyl 5-[[2-cyano-2-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3797117 |
| Molecular Formula | C26H25N3O4S2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 4-O-ethyl 2-O-prop-2-enyl 5-[[2-cyano-2-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | C=CCOC(=O)c1sc(NC=C(C#N)c2nc(-c3ccc(CC)cc3)cs2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C26H25N3O4S2/c1-5-12-33-26(31)22-16(4)21(25(30)32-7-3)24(35-22)28-14-19(13-27)23-29-20(15-34-23)18-10-8-17(6-2)9-11-18/h5,8-11,14-15,28H,1,6-7,12H2,2-4H3 |
| InChIKey | ZJEHLOJQTKPCFI-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|