C23H20ClN3O4S2 — CID 3747311
diethyl 5-[[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 3747311) has the molecular formula C23H20ClN3O4S2 and a molecular weight of 502.02 g/mol. Its IUPAC name is diethyl 5-[[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3747311 |
| Molecular Formula | C23H20ClN3O4S2 |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | diethyl 5-[[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC=C(C#N)c2nc(-c3ccc(Cl)cc3)cs2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C23H20ClN3O4S2/c1-4-30-22(28)18-13(3)19(23(29)31-5-2)33-21(18)26-11-15(10-25)20-27-17(12-32-20)14-6-8-16(24)9-7-14/h6-9,11-12,26H,4-5H2,1-3H3 |
| InChIKey | UQDXKKUQSZLJDS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|