C23H15N3O3S — CID 6230489
(E)-3-(2-methoxy-5-nitrophenyl)-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 6230489) has the molecular formula C23H15N3O3S and a molecular weight of 413.46 g/mol. Its IUPAC name is (E)-3-(2-methoxy-5-nitrophenyl)-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(2-methoxy-5-nitrophenyl)-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6230489 |
| Molecular Formula | C23H15N3O3S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | (E)-3-(2-methoxy-5-nitrophenyl)-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | COc1ccc([N+](=O)[O-])cc1/C=C(\C#N)c1nc(-c2cccc3ccccc23)cs1 |
| InChI | InChI=1S/C23H15N3O3S/c1-29-22-10-9-18(26(27)28)12-16(22)11-17(13-24)23-25-21(14-30-23)20-8-4-6-15-5-2-3-7-19(15)20/h2-12,14H,1H3/b17-11+ |
| InChIKey | JANIXJKKUPEECC-GZTJUZNOSA-N |
| XLogP | 5.94 |
| TPSA | 89.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|