C18H10BrN3O2S — CID 3898172
3-(2-bromophenyl)-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 3898172) has the molecular formula C18H10BrN3O2S and a molecular weight of 412.27 g/mol. Its IUPAC name is 3-(2-bromophenyl)-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(2-bromophenyl)-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3898172 |
| Molecular Formula | C18H10BrN3O2S |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | 3-(2-bromophenyl)-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccccc1Br)c1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C18H10BrN3O2S/c19-16-7-2-1-4-12(16)8-14(10-20)18-21-17(11-25-18)13-5-3-6-15(9-13)22(23)24/h1-9,11H |
| InChIKey | RSFRDOZUWRTDIV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|