C21H12BrN5O2S — CID 18807285
(Z)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enenitrile (PubChem CID 18807285) has the molecular formula C21H12BrN5O2S and a molecular weight of 478.33 g/mol. Its IUPAC name is (Z)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 18807285 |
| Molecular Formula | C21H12BrN5O2S |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | (Z)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cn[nH]c1-c1cccc([N+](=O)[O-])c1)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C21H12BrN5O2S/c22-17-6-4-13(5-7-17)19-12-30-21(25-19)15(10-23)8-16-11-24-26-20(16)14-2-1-3-18(9-14)27(28)29/h1-9,11-12H,(H,24,26)/b15-8- |
| InChIKey | BTBQEPJHRREBSB-NVNXTCNLSA-N |
| XLogP | 5.94 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|