C19H11N5O3S — CID 18824001
(Z)-2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enenitrile (PubChem CID 18824001) has the molecular formula C19H11N5O3S and a molecular weight of 389.40 g/mol. Its IUPAC name is (Z)-2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 18824001 |
| Molecular Formula | C19H11N5O3S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | (Z)-2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cn[nH]c1-c1cccc([N+](=O)[O-])c1)c1nc(-c2ccco2)cs1 |
| InChI | InChI=1S/C19H11N5O3S/c20-9-13(19-22-16(11-28-19)17-5-2-6-27-17)7-14-10-21-23-18(14)12-3-1-4-15(8-12)24(25)26/h1-8,10-11H,(H,21,23)/b13-7- |
| InChIKey | BUUGANQFNXMSTC-QPEQYQDCSA-N |
| XLogP | 4.77 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|