C20H16N4O4 — CID 18807161
(E)-2-(3,4-dimethoxyphenyl)-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enenitrile (PubChem CID 18807161) has the molecular formula C20H16N4O4 and a molecular weight of 376.37 g/mol. Its IUPAC name is (E)-2-(3,4-dimethoxyphenyl)-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(3,4-dimethoxyphenyl)-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 18807161 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (E)-2-(3,4-dimethoxyphenyl)-3-[5-(3-nitrophenyl)-1H-pyrazol-4-yl]prop-2-enenitrile |
| SMILES | COc1ccc(/C(C#N)=C\c2cn[nH]c2-c2cccc([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C20H16N4O4/c1-27-18-7-6-13(10-19(18)28-2)15(11-21)8-16-12-22-23-20(16)14-4-3-5-17(9-14)24(25)26/h3-10,12H,1-2H3,(H,22,23)/b15-8- |
| InChIKey | YJCLBOLYCIGGNJ-NVNXTCNLSA-N |
| XLogP | 4.07 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|