C16H10Br2N2O4 — CID 3589626
3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-(3-nitrophenyl)prop-2-enenitrile (PubChem CID 3589626) has the molecular formula C16H10Br2N2O4 and a molecular weight of 454.07 g/mol. Its IUPAC name is 3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-(3-nitrophenyl)prop-2-enenitrile.
| Compound Name | 3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-(3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3589626 |
| Molecular Formula | C16H10Br2N2O4 |
| Molecular Weight | 454.07 g/mol |
| Exact Mass | 451.90 |
| IUPAC Name | 3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-(3-nitrophenyl)prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)c2cccc([N+](=O)[O-])c2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C16H10Br2N2O4/c1-24-13-7-10(14(17)15(18)16(13)21)5-11(8-19)9-3-2-4-12(6-9)20(22)23/h2-7,21H,1H3 |
| InChIKey | ZHWUAWZDLNBXLA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 96.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.07 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|