C17H12N2O5 — CID 4223577
3-(6-methoxy-1,3-benzodioxol-5-yl)-2-(3-nitrophenyl)prop-2-enenitrile (PubChem CID 4223577) has the molecular formula C17H12N2O5 and a molecular weight of 324.29 g/mol. Its IUPAC name is 3-(6-methoxy-1,3-benzodioxol-5-yl)-2-(3-nitrophenyl)prop-2-enenitrile.
| Compound Name | 3-(6-methoxy-1,3-benzodioxol-5-yl)-2-(3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4223577 |
| Molecular Formula | C17H12N2O5 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 3-(6-methoxy-1,3-benzodioxol-5-yl)-2-(3-nitrophenyl)prop-2-enenitrile |
| SMILES | COc1cc2c(cc1C=C(C#N)c1cccc([N+](=O)[O-])c1)OCO2 |
| InChI | InChI=1S/C17H12N2O5/c1-22-15-8-17-16(23-10-24-17)7-12(15)5-13(9-18)11-3-2-4-14(6-11)19(20)21/h2-8H,10H2,1H3 |
| InChIKey | APAFSKOVVIBOKH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 94.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|