C16H9N3O6 — CID 2247731
(Z)-3-(6-nitro-1,3-benzodioxol-5-yl)-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 2247731) has the molecular formula C16H9N3O6 and a molecular weight of 339.26 g/mol. Its IUPAC name is (Z)-3-(6-nitro-1,3-benzodioxol-5-yl)-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(6-nitro-1,3-benzodioxol-5-yl)-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2247731 |
| Molecular Formula | C16H9N3O6 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | (Z)-3-(6-nitro-1,3-benzodioxol-5-yl)-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc2c(cc1[N+](=O)[O-])OCO2)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H9N3O6/c17-8-12(10-1-3-13(4-2-10)18(20)21)5-11-6-15-16(25-9-24-15)7-14(11)19(22)23/h1-7H,9H2/b12-5+ |
| InChIKey | AKUZJBQEUPEONU-LFYBBSHMSA-N |
| XLogP | 3.30 |
| TPSA | 128.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|