C17H9ClNO4- — CID 7030088
4-[2-(6-chloro-1,3-benzodioxol-5-yl)-1-cyanoethenyl]benzoate (PubChem CID 7030088) has the molecular formula C17H9ClNO4- and a molecular weight of 326.72 g/mol. Its IUPAC name is 4-[2-(6-chloro-1,3-benzodioxol-5-yl)-1-cyanoethenyl]benzoate.
| Compound Name | 4-[2-(6-chloro-1,3-benzodioxol-5-yl)-1-cyanoethenyl]benzoate |
|---|---|
| PubChem CID | 7030088 |
| Molecular Formula | C17H9ClNO4- |
| Molecular Weight | 326.72 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 4-[2-(6-chloro-1,3-benzodioxol-5-yl)-1-cyanoethenyl]benzoate |
| SMILES | N#CC(=Cc1cc2c(cc1Cl)OCO2)c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H10ClNO4/c18-14-7-16-15(22-9-23-16)6-12(14)5-13(8-19)10-1-3-11(4-2-10)17(20)21/h1-7H,9H2,(H,20,21)/p-1 |
| InChIKey | AUIXCIFNYYMRHQ-UHFFFAOYSA-M |
| XLogP | 2.50 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.72 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|