C17H9Cl3N2O3 — CID 4634545
3-(6-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide (PubChem CID 4634545) has the molecular formula C17H9Cl3N2O3 and a molecular weight of 395.63 g/mol. Its IUPAC name is 3-(6-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide.
| Compound Name | 3-(6-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4634545 |
| Molecular Formula | C17H9Cl3N2O3 |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | 3-(6-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1cc2c(cc1Cl)OCO2)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H9Cl3N2O3/c18-11-1-2-12(19)14(5-11)22-17(23)10(7-21)3-9-4-15-16(6-13(9)20)25-8-24-15/h1-6H,8H2,(H,22,23) |
| InChIKey | MUVCUXLRFVNAAB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|