C14H7Cl3N2OS — CID 24604556
(E)-3-(5-chlorothiophen-2-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide (PubChem CID 24604556) has the molecular formula C14H7Cl3N2OS and a molecular weight of 357.65 g/mol. Its IUPAC name is (E)-3-(5-chlorothiophen-2-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(5-chlorothiophen-2-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 24604556 |
| Molecular Formula | C14H7Cl3N2OS |
| Molecular Weight | 357.65 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | (E)-3-(5-chlorothiophen-2-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(Cl)s1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H7Cl3N2OS/c15-9-1-3-11(16)12(6-9)19-14(20)8(7-18)5-10-2-4-13(17)21-10/h1-6H,(H,19,20)/b8-5+ |
| InChIKey | OXHZJROSNMWVGM-VMPITWQZSA-N |
| XLogP | 5.25 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|