C16H12Cl2N4O3 — CID 24632674
(E)-2-cyano-N-(2,5-dichlorophenyl)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide (PubChem CID 24632674) has the molecular formula C16H12Cl2N4O3 and a molecular weight of 379.20 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,5-dichlorophenyl)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,5-dichlorophenyl)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 24632674 |
| Molecular Formula | C16H12Cl2N4O3 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | (E)-2-cyano-N-(2,5-dichlorophenyl)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide |
| SMILES | Cn1cc(/C=C(\C#N)C(=O)Nc2cc(Cl)ccc2Cl)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H12Cl2N4O3/c1-21-8-10(15(24)22(2)16(21)25)5-9(7-19)14(23)20-13-6-11(17)3-4-12(13)18/h3-6,8H,1-2H3,(H,20,23)/b9-5+ |
| InChIKey | CYFFNJYNGCOKCT-WEVVVXLNSA-N |
| XLogP | 1.94 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|