C14H8Cl2N2OS — CID 2376096
(E)-2-cyano-N-(2,5-dichlorophenyl)-3-thiophen-3-ylprop-2-enamide (PubChem CID 2376096) has the molecular formula C14H8Cl2N2OS and a molecular weight of 323.20 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,5-dichlorophenyl)-3-thiophen-3-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,5-dichlorophenyl)-3-thiophen-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 2376096 |
| Molecular Formula | C14H8Cl2N2OS |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | (E)-2-cyano-N-(2,5-dichlorophenyl)-3-thiophen-3-ylprop-2-enamide |
| SMILES | N#C/C(=C\c1ccsc1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H8Cl2N2OS/c15-11-1-2-12(16)13(6-11)18-14(19)10(7-17)5-9-3-4-20-8-9/h1-6,8H,(H,18,19)/b10-5+ |
| InChIKey | BWKGPUYFXNTROL-BJMVGYQFSA-N |
| XLogP | 4.60 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|