C14H11ClN2O3 — CID 6004554
(E)-3-(6-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-cyclopropylprop-2-enamide (PubChem CID 6004554) has the molecular formula C14H11ClN2O3 and a molecular weight of 290.71 g/mol. Its IUPAC name is (E)-3-(6-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-cyclopropylprop-2-enamide.
| Compound Name | (E)-3-(6-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-cyclopropylprop-2-enamide |
|---|---|
| PubChem CID | 6004554 |
| Molecular Formula | C14H11ClN2O3 |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | (E)-3-(6-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-cyclopropylprop-2-enamide |
| SMILES | N#C/C(=C\c1cc2c(cc1Cl)OCO2)C(=O)NC1CC1 |
| InChI | InChI=1S/C14H11ClN2O3/c15-11-5-13-12(19-7-20-13)4-8(11)3-9(6-16)14(18)17-10-1-2-10/h3-5,10H,1-2,7H2,(H,17,18)/b9-3+ |
| InChIKey | KYYGVUKHTSQAFK-YCRREMRBSA-N |
| XLogP | 2.25 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|