C21H19ClN2O3 — CID 3650917
3-(6-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide (PubChem CID 3650917) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is 3-(6-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide.
| Compound Name | 3-(6-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 3650917 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 3-(6-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide |
| SMILES | CCc1ccc(C(C)NC(=O)C(C#N)=Cc2cc3c(cc2Cl)OCO3)cc1 |
| InChI | InChI=1S/C21H19ClN2O3/c1-3-14-4-6-15(7-5-14)13(2)24-21(25)17(11-23)8-16-9-19-20(10-18(16)22)27-12-26-19/h4-10,13H,3,12H2,1-2H3,(H,24,25) |
| InChIKey | KIXVUARLPBWABG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|