C19H15ClN2O3 — CID 43025648
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-(1-phenylethyl)prop-2-enamide (PubChem CID 43025648) has the molecular formula C19H15ClN2O3 and a molecular weight of 354.79 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-(1-phenylethyl)prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-(1-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 43025648 |
| Molecular Formula | C19H15ClN2O3 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-(1-phenylethyl)prop-2-enamide |
| SMILES | CC(NC(=O)/C(C#N)=C/c1cc(Cl)c2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C19H15ClN2O3/c1-12(14-5-3-2-4-6-14)22-19(23)15(10-21)7-13-8-16(20)18-17(9-13)24-11-25-18/h2-9,12H,11H2,1H3,(H,22,23)/b15-7+ |
| InChIKey | YMCOJIZFVKOJRP-VIZOYTHASA-N |
| XLogP | 3.85 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|