C20H18N2O4 — CID 126253612
(Z)-2-cyano-3-(6-methoxy-1,3-benzodioxol-5-yl)-N-[(1S)-1-phenylethyl]prop-2-enamide (PubChem CID 126253612) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is (Z)-2-cyano-3-(6-methoxy-1,3-benzodioxol-5-yl)-N-[(1S)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(6-methoxy-1,3-benzodioxol-5-yl)-N-[(1S)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126253612 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (Z)-2-cyano-3-(6-methoxy-1,3-benzodioxol-5-yl)-N-[(1S)-1-phenylethyl]prop-2-enamide |
| SMILES | COc1cc2c(cc1/C=C(/C#N)C(=O)N[C@@H](C)c1ccccc1)OCO2 |
| InChI | InChI=1S/C20H18N2O4/c1-13(14-6-4-3-5-7-14)22-20(23)16(11-21)8-15-9-18-19(26-12-25-18)10-17(15)24-2/h3-10,13H,12H2,1-2H3,(H,22,23)/b16-8-/t13-/m0/s1 |
| InChIKey | HFZMGLMSLVGEAU-TUTDSIAXSA-N |
| XLogP | 3.21 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|