C17H10ClN3O5 — CID 2875752
N-(4-chlorophenyl)-2-cyano-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide (PubChem CID 2875752) has the molecular formula C17H10ClN3O5 and a molecular weight of 371.74 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-cyano-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide.
| Compound Name | N-(4-chlorophenyl)-2-cyano-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2875752 |
| Molecular Formula | C17H10ClN3O5 |
| Molecular Weight | 371.74 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-(4-chlorophenyl)-2-cyano-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide |
| SMILES | N#CC(=Cc1cc2c(cc1[N+](=O)[O-])OCO2)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H10ClN3O5/c18-12-1-3-13(4-2-12)20-17(22)11(8-19)5-10-6-15-16(26-9-25-15)7-14(10)21(23)24/h1-7H,9H2,(H,20,22) |
| InChIKey | RWDNUHKTBWDKKU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.74 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|