C17H11ClN4O5 — CID 108852390
(Z)-3-(1,3-benzodioxol-5-ylamino)-N-(4-chloro-3-nitrophenyl)-2-cyanoprop-2-enamide (PubChem CID 108852390) has the molecular formula C17H11ClN4O5 and a molecular weight of 386.75 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-ylamino)-N-(4-chloro-3-nitrophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(1,3-benzodioxol-5-ylamino)-N-(4-chloro-3-nitrophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108852390 |
| Molecular Formula | C17H11ClN4O5 |
| Molecular Weight | 386.75 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-ylamino)-N-(4-chloro-3-nitrophenyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc2c(c1)OCO2)C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H11ClN4O5/c18-13-3-1-12(5-14(13)22(24)25)21-17(23)10(7-19)8-20-11-2-4-15-16(6-11)27-9-26-15/h1-6,8,20H,9H2,(H,21,23)/b10-8- |
| InChIKey | DNYBVDFSRWGPDS-NTMALXAHSA-N |
| XLogP | 3.43 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.75 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|