C13H10ClN5O3S — CID 108852367
(Z)-N-(4-chloro-3-nitrophenyl)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide (PubChem CID 108852367) has the molecular formula C13H10ClN5O3S and a molecular weight of 351.78 g/mol. Its IUPAC name is (Z)-N-(4-chloro-3-nitrophenyl)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-(4-chloro-3-nitrophenyl)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108852367 |
| Molecular Formula | C13H10ClN5O3S |
| Molecular Weight | 351.78 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | (Z)-N-(4-chloro-3-nitrophenyl)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/NC1=NCCS1)C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10ClN5O3S/c14-10-2-1-9(5-11(10)19(21)22)18-12(20)8(6-15)7-17-13-16-3-4-23-13/h1-2,5,7H,3-4H2,(H,16,17)(H,18,20)/b8-7- |
| InChIKey | QZRCCZYHAWYEOJ-FPLPWBNLSA-N |
| XLogP | 2.29 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.78 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|