C13H11ClN4OS — CID 108860532
(Z)-N-(3-chlorophenyl)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide (PubChem CID 108860532) has the molecular formula C13H11ClN4OS and a molecular weight of 306.78 g/mol. Its IUPAC name is (Z)-N-(3-chlorophenyl)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-(3-chlorophenyl)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108860532 |
| Molecular Formula | C13H11ClN4OS |
| Molecular Weight | 306.78 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | (Z)-N-(3-chlorophenyl)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/NC1=NCCS1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H11ClN4OS/c14-10-2-1-3-11(6-10)18-12(19)9(7-15)8-17-13-16-4-5-20-13/h1-3,6,8H,4-5H2,(H,16,17)(H,18,19)/b9-8- |
| InChIKey | LTOBAHXPDSSDAN-HJWRWDBZSA-N |
| XLogP | 2.38 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.78 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|