C15H15N5O2S — CID 108818791
(Z)-N-(4-acetamidophenyl)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide (PubChem CID 108818791) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is (Z)-N-(4-acetamidophenyl)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-(4-acetamidophenyl)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108818791 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (Z)-N-(4-acetamidophenyl)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)/C(C#N)=C\NC2=NCCS2)cc1 |
| InChI | InChI=1S/C15H15N5O2S/c1-10(21)19-12-2-4-13(5-3-12)20-14(22)11(8-16)9-18-15-17-6-7-23-15/h2-5,9H,6-7H2,1H3,(H,17,18)(H,19,21)(H,20,22)/b11-9- |
| InChIKey | YZWSMAHHWLMNAV-LUAWRHEFSA-N |
| XLogP | 1.68 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|