C15H16N4O2S — CID 108858335
(Z)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)-N-(2-methoxy-5-methylphenyl)prop-2-enamide (PubChem CID 108858335) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)-N-(2-methoxy-5-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)-N-(2-methoxy-5-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108858335 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (Z)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)-N-(2-methoxy-5-methylphenyl)prop-2-enamide |
| SMILES | COc1ccc(C)cc1NC(=O)/C(C#N)=C\NC1=NCCS1 |
| InChI | InChI=1S/C15H16N4O2S/c1-10-3-4-13(21-2)12(7-10)19-14(20)11(8-16)9-18-15-17-5-6-22-15/h3-4,7,9H,5-6H2,1-2H3,(H,17,18)(H,19,20)/b11-9- |
| InChIKey | ZORYMBWJBJYBNK-LUAWRHEFSA-N |
| XLogP | 2.04 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|