C20H21N3O4 — CID 108858177
(Z)-2-cyano-3-(2,5-dimethoxyanilino)-N-(2-methoxy-5-methylphenyl)prop-2-enamide (PubChem CID 108858177) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,5-dimethoxyanilino)-N-(2-methoxy-5-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,5-dimethoxyanilino)-N-(2-methoxy-5-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108858177 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (Z)-2-cyano-3-(2,5-dimethoxyanilino)-N-(2-methoxy-5-methylphenyl)prop-2-enamide |
| SMILES | COc1ccc(OC)c(N/C=C(/C#N)C(=O)Nc2cc(C)ccc2OC)c1 |
| InChI | InChI=1S/C20H21N3O4/c1-13-5-7-19(27-4)17(9-13)23-20(24)14(11-21)12-22-16-10-15(25-2)6-8-18(16)26-3/h5-10,12,22H,1-4H3,(H,23,24)/b14-12- |
| InChIKey | OBLSQNAWVSSYEY-OWBHPGMISA-N |
| XLogP | 3.48 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|