C20H21N3O3 — CID 108857887
(Z)-2-cyano-3-(2,4-dimethoxyanilino)-N-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 108857887) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,4-dimethoxyanilino)-N-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,4-dimethoxyanilino)-N-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108857887 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (Z)-2-cyano-3-(2,4-dimethoxyanilino)-N-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | COc1ccc(N/C=C(/C#N)C(=O)Nc2ccc(C)cc2C)c(OC)c1 |
| InChI | InChI=1S/C20H21N3O3/c1-13-5-7-17(14(2)9-13)23-20(24)15(11-21)12-22-18-8-6-16(25-3)10-19(18)26-4/h5-10,12,22H,1-4H3,(H,23,24)/b15-12- |
| InChIKey | UTGBJSLWMKCXBF-QINSGFPZSA-N |
| XLogP | 3.78 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|