C19H19N3O4 — CID 108850428
(Z)-2-cyano-N-(2,5-dimethoxyphenyl)-3-(2-hydroxy-5-methylanilino)prop-2-enamide (PubChem CID 108850428) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,5-dimethoxyphenyl)-3-(2-hydroxy-5-methylanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,5-dimethoxyphenyl)-3-(2-hydroxy-5-methylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108850428 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (Z)-2-cyano-N-(2,5-dimethoxyphenyl)-3-(2-hydroxy-5-methylanilino)prop-2-enamide |
| SMILES | COc1ccc(OC)c(NC(=O)/C(C#N)=C\Nc2cc(C)ccc2O)c1 |
| InChI | InChI=1S/C19H19N3O4/c1-12-4-6-17(23)15(8-12)21-11-13(10-20)19(24)22-16-9-14(25-2)5-7-18(16)26-3/h4-9,11,21,23H,1-3H3,(H,22,24)/b13-11- |
| InChIKey | ILQQNKFXTFCXNJ-QBFSEMIESA-N |
| XLogP | 3.18 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|