C18H15Cl2N3O3 — CID 108850548
(Z)-2-cyano-3-(2,6-dichloroanilino)-N-(2,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 108850548) has the molecular formula C18H15Cl2N3O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,6-dichloroanilino)-N-(2,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,6-dichloroanilino)-N-(2,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108850548 |
| Molecular Formula | C18H15Cl2N3O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | (Z)-2-cyano-3-(2,6-dichloroanilino)-N-(2,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(OC)c(NC(=O)/C(C#N)=C\Nc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C18H15Cl2N3O3/c1-25-12-6-7-16(26-2)15(8-12)23-18(24)11(9-21)10-22-17-13(19)4-3-5-14(17)20/h3-8,10,22H,1-2H3,(H,23,24)/b11-10- |
| InChIKey | GQPCGWIXKIXJLB-KHPPLWFESA-N |
| XLogP | 4.47 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|