C16H14N2O3S — CID 4504662
2-cyano-N-(2,5-dimethoxyphenyl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 4504662) has the molecular formula C16H14N2O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is 2-cyano-N-(2,5-dimethoxyphenyl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | 2-cyano-N-(2,5-dimethoxyphenyl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4504662 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-cyano-N-(2,5-dimethoxyphenyl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(C#N)=Cc2cccs2)c1 |
| InChI | InChI=1S/C16H14N2O3S/c1-20-12-5-6-15(21-2)14(9-12)18-16(19)11(10-17)8-13-4-3-7-22-13/h3-9H,1-2H3,(H,18,19) |
| InChIKey | UHDLLPBVFDBBPM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|