C16H19N3O4 — CID 108850336
(Z)-2-cyano-N-(2,5-dimethoxyphenyl)-3-morpholin-4-ylprop-2-enamide (PubChem CID 108850336) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,5-dimethoxyphenyl)-3-morpholin-4-ylprop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,5-dimethoxyphenyl)-3-morpholin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 108850336 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (Z)-2-cyano-N-(2,5-dimethoxyphenyl)-3-morpholin-4-ylprop-2-enamide |
| SMILES | COc1ccc(OC)c(NC(=O)/C(C#N)=C\N2CCOCC2)c1 |
| InChI | InChI=1S/C16H19N3O4/c1-21-13-3-4-15(22-2)14(9-13)18-16(20)12(10-17)11-19-5-7-23-8-6-19/h3-4,9,11H,5-8H2,1-2H3,(H,18,20)/b12-11- |
| InChIKey | QWZPYURVUKHTEX-QXMHVHEDSA-N |
| XLogP | 1.38 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|