C17H21N3O2 — CID 108851082
(Z)-2-cyano-3-morpholin-4-yl-N-(2,4,6-trimethylphenyl)prop-2-enamide (PubChem CID 108851082) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is (Z)-2-cyano-3-morpholin-4-yl-N-(2,4,6-trimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-morpholin-4-yl-N-(2,4,6-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108851082 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | (Z)-2-cyano-3-morpholin-4-yl-N-(2,4,6-trimethylphenyl)prop-2-enamide |
| SMILES | Cc1cc(C)c(NC(=O)/C(C#N)=C\N2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C17H21N3O2/c1-12-8-13(2)16(14(3)9-12)19-17(21)15(10-18)11-20-4-6-22-7-5-20/h8-9,11H,4-7H2,1-3H3,(H,19,21)/b15-11- |
| InChIKey | SJXNANOKXIMEIW-PTNGSMBKSA-N |
| XLogP | 2.29 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|