C19H24N4O3 — CID 108851371
methyl 4-[(Z)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]piperazine-1-carboxylate (PubChem CID 108851371) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is methyl 4-[(Z)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[(Z)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108851371 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | methyl 4-[(Z)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(/C=C(/C#N)C(=O)Nc2c(C)cc(C)cc2C)CC1 |
| InChI | InChI=1S/C19H24N4O3/c1-13-9-14(2)17(15(3)10-13)21-18(24)16(11-20)12-22-5-7-23(8-6-22)19(25)26-4/h9-10,12H,5-8H2,1-4H3,(H,21,24)/b16-12- |
| InChIKey | RVCMJNWRWFHYRE-VBKFSLOCSA-N |
| XLogP | 2.34 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|