C20H19N3O3 — CID 108851027
4-[[(Z)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]amino]benzoic acid (PubChem CID 108851027) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]amino]benzoic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108851027 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]amino]benzoic acid |
| SMILES | Cc1cc(C)c(NC(=O)/C(C#N)=C\Nc2ccc(C(=O)O)cc2)c(C)c1 |
| InChI | InChI=1S/C20H19N3O3/c1-12-8-13(2)18(14(3)9-12)23-19(24)16(10-21)11-22-17-6-4-15(5-7-17)20(25)26/h4-9,11,22H,1-3H3,(H,23,24)(H,25,26)/b16-11- |
| InChIKey | YHAUNLAKYBVDAI-WJDWOHSUSA-N |
| XLogP | 3.77 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|