C23H25ClN4O4S — CID 108851152
(Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N-(2,4,6-trimethylphenyl)prop-2-enamide (PubChem CID 108851152) has the molecular formula C23H25ClN4O4S and a molecular weight of 489.00 g/mol. Its IUPAC name is (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N-(2,4,6-trimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N-(2,4,6-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108851152 |
| Molecular Formula | C23H25ClN4O4S |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N-(2,4,6-trimethylphenyl)prop-2-enamide |
| SMILES | Cc1cc(C)c(NC(=O)/C(C#N)=C\Nc2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)c(C)c1 |
| InChI | InChI=1S/C23H25ClN4O4S/c1-15-10-16(2)22(17(3)11-15)27-23(29)18(13-25)14-26-21-12-19(4-5-20(21)24)33(30,31)28-6-8-32-9-7-28/h4-5,10-12,14,26H,6-9H2,1-3H3,(H,27,29)/b18-14- |
| InChIKey | XOCLSBVROJTHPL-JXAWBTAJSA-N |
| XLogP | 3.74 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|