C20H23ClN4O4S — CID 108861164
(Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N,N-bis(prop-2-enyl)prop-2-enamide (PubChem CID 108861164) has the molecular formula C20H23ClN4O4S and a molecular weight of 450.95 g/mol. Its IUPAC name is (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N,N-bis(prop-2-enyl)prop-2-enamide.
| Compound Name | (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N,N-bis(prop-2-enyl)prop-2-enamide |
|---|---|
| PubChem CID | 108861164 |
| Molecular Formula | C20H23ClN4O4S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N,N-bis(prop-2-enyl)prop-2-enamide |
| SMILES | C=CCN(CC=C)C(=O)/C(C#N)=C\Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C20H23ClN4O4S/c1-3-7-24(8-4-2)20(26)16(14-22)15-23-19-13-17(5-6-18(19)21)30(27,28)25-9-11-29-12-10-25/h3-6,13,15,23H,1-2,7-12H2/b16-15- |
| InChIKey | LBLYJOBUAYMNNF-NXVVXOECSA-N |
| XLogP | 2.38 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|