C25H29ClN4O5S — CID 108847795
(Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N-[1-(2-ethoxy-5-methylphenyl)ethyl]prop-2-enamide (PubChem CID 108847795) has the molecular formula C25H29ClN4O5S and a molecular weight of 533.05 g/mol. Its IUPAC name is (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N-[1-(2-ethoxy-5-methylphenyl)ethyl]prop-2-enamide.
| Compound Name | (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N-[1-(2-ethoxy-5-methylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108847795 |
| Molecular Formula | C25H29ClN4O5S |
| Molecular Weight | 533.05 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-cyano-N-[1-(2-ethoxy-5-methylphenyl)ethyl]prop-2-enamide |
| SMILES | CCOc1ccc(C)cc1C(C)NC(=O)/C(C#N)=C\Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C25H29ClN4O5S/c1-4-35-24-8-5-17(2)13-21(24)18(3)29-25(31)19(15-27)16-28-23-14-20(6-7-22(23)26)36(32,33)30-9-11-34-12-10-30/h5-8,13-14,16,18,28H,4,9-12H2,1-3H3,(H,29,31)/b19-16- |
| InChIKey | PXXSPNVZCPAZOA-MNDPQUGUSA-N |
| XLogP | 3.76 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.05 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|