C16H19N3O6S — CID 8812538
ethyl (E)-2-cyano-3-(2-hydroxy-5-morpholin-4-ylsulfonylanilino)prop-2-enoate (PubChem CID 8812538) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-(2-hydroxy-5-morpholin-4-ylsulfonylanilino)prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-(2-hydroxy-5-morpholin-4-ylsulfonylanilino)prop-2-enoate |
|---|---|
| PubChem CID | 8812538 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | ethyl (E)-2-cyano-3-(2-hydroxy-5-morpholin-4-ylsulfonylanilino)prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1cc(S(=O)(=O)N2CCOCC2)ccc1O |
| InChI | InChI=1S/C16H19N3O6S/c1-2-25-16(21)12(10-17)11-18-14-9-13(3-4-15(14)20)26(22,23)19-5-7-24-8-6-19/h3-4,9,11,18,20H,2,5-8H2,1H3/b12-11+ |
| InChIKey | PHCPONYCAJUNIZ-VAWYXSNFSA-N |
| XLogP | 0.80 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|