C20H18Cl2N4O4S — CID 108824396
(Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-N-(2-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 108824396) has the molecular formula C20H18Cl2N4O4S and a molecular weight of 481.36 g/mol. Its IUPAC name is (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-N-(2-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-N-(2-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108824396 |
| Molecular Formula | C20H18Cl2N4O4S |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | (Z)-3-(2-chloro-5-morpholin-4-ylsulfonylanilino)-N-(2-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C20H18Cl2N4O4S/c21-16-3-1-2-4-18(16)25-20(27)14(12-23)13-24-19-11-15(5-6-17(19)22)31(28,29)26-7-9-30-10-8-26/h1-6,11,13,24H,7-10H2,(H,25,27)/b14-13- |
| InChIKey | XJRUIOCOAUEFCL-YPKPFQOOSA-N |
| XLogP | 3.47 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|