C21H22N2O5 — CID 19172841
(E)-2-cyano-N-(2,5-dimethoxyphenyl)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 19172841) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,5-dimethoxyphenyl)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,5-dimethoxyphenyl)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19172841 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (E)-2-cyano-N-(2,5-dimethoxyphenyl)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C(\C#N)C(=O)Nc2cc(OC)ccc2OC)cc1OC |
| InChI | InChI=1S/C21H22N2O5/c1-5-28-19-8-6-14(11-20(19)27-4)10-15(13-22)21(24)23-17-12-16(25-2)7-9-18(17)26-3/h6-12H,5H2,1-4H3,(H,23,24)/b15-10+ |
| InChIKey | NFTFXLKWNVNHGC-XNTDXEJSSA-N |
| XLogP | 3.66 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|