C19H15ClF3N3O3 — CID 108850545
(Z)-3-[4-chloro-2-(trifluoromethyl)anilino]-2-cyano-N-(2,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 108850545) has the molecular formula C19H15ClF3N3O3 and a molecular weight of 425.79 g/mol. Its IUPAC name is (Z)-3-[4-chloro-2-(trifluoromethyl)anilino]-2-cyano-N-(2,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-chloro-2-(trifluoromethyl)anilino]-2-cyano-N-(2,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108850545 |
| Molecular Formula | C19H15ClF3N3O3 |
| Molecular Weight | 425.79 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | (Z)-3-[4-chloro-2-(trifluoromethyl)anilino]-2-cyano-N-(2,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(OC)c(NC(=O)/C(C#N)=C\Nc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15ClF3N3O3/c1-28-13-4-6-17(29-2)16(8-13)26-18(27)11(9-24)10-25-15-5-3-12(20)7-14(15)19(21,22)23/h3-8,10,25H,1-2H3,(H,26,27)/b11-10- |
| InChIKey | LRSIGCZZKYHJIC-KHPPLWFESA-N |
| XLogP | 4.83 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.79 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|