C14H14N4OS — CID 108842319
(Z)-N-benzyl-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide (PubChem CID 108842319) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is (Z)-N-benzyl-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-benzyl-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108842319 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (Z)-N-benzyl-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/NC1=NCCS1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C14H14N4OS/c15-8-12(10-18-14-16-6-7-20-14)13(19)17-9-11-4-2-1-3-5-11/h1-5,10H,6-7,9H2,(H,16,18)(H,17,19)/b12-10- |
| InChIKey | CBXVTYGINBALPZ-BENRWUELSA-N |
| XLogP | 1.40 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|