C13H18N4O3S — CID 108845290
6-[[(Z)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enoyl]amino]hexanoic acid (PubChem CID 108845290) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 6-[[(Z)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enoyl]amino]hexanoic acid.
| Compound Name | 6-[[(Z)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 108845290 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 6-[[(Z)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)prop-2-enoyl]amino]hexanoic acid |
| SMILES | N#C/C(=C/NC1=NCCS1)C(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C13H18N4O3S/c14-8-10(9-17-13-16-6-7-21-13)12(20)15-5-3-1-2-4-11(18)19/h9H,1-7H2,(H,15,20)(H,16,17)(H,18,19)/b10-9- |
| InChIKey | LFOVKFDLYYAJBM-KTKRTIGZSA-N |
| XLogP | 0.85 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|