C23H17ClN4O3 — CID 108852182
(Z)-3-(benzhydrylamino)-N-(4-chloro-3-nitrophenyl)-2-cyanoprop-2-enamide (PubChem CID 108852182) has the molecular formula C23H17ClN4O3 and a molecular weight of 432.87 g/mol. Its IUPAC name is (Z)-3-(benzhydrylamino)-N-(4-chloro-3-nitrophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(benzhydrylamino)-N-(4-chloro-3-nitrophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108852182 |
| Molecular Formula | C23H17ClN4O3 |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | (Z)-3-(benzhydrylamino)-N-(4-chloro-3-nitrophenyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/NC(c1ccccc1)c1ccccc1)C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H17ClN4O3/c24-20-12-11-19(13-21(20)28(30)31)27-23(29)18(14-25)15-26-22(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-13,15,22,26H,(H,27,29)/b18-15- |
| InChIKey | IVSFRFFTGQQPJR-SDXDJHTJSA-N |
| XLogP | 4.97 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|