C12H9ClN4O5 — CID 108844018
2-[[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]amino]acetic acid (PubChem CID 108844018) has the molecular formula C12H9ClN4O5 and a molecular weight of 324.68 g/mol. Its IUPAC name is 2-[[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 108844018 |
| Molecular Formula | C12H9ClN4O5 |
| Molecular Weight | 324.68 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 2-[[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]amino]acetic acid |
| SMILES | N#C/C(=C/Nc1ccc(Cl)c([N+](=O)[O-])c1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C12H9ClN4O5/c13-9-2-1-8(3-10(9)17(21)22)15-5-7(4-14)12(20)16-6-11(18)19/h1-3,5,15H,6H2,(H,16,20)(H,18,19)/b7-5- |
| InChIKey | IIWVHCSJMUYKNH-ALCCZGGFSA-N |
| XLogP | 1.27 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.68 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|