C17H18ClN5O4 — CID 108815414
(Z)-3-(4-chloro-3-nitroanilino)-2-cyano-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide (PubChem CID 108815414) has the molecular formula C17H18ClN5O4 and a molecular weight of 391.82 g/mol. Its IUPAC name is (Z)-3-(4-chloro-3-nitroanilino)-2-cyano-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide.
| Compound Name | (Z)-3-(4-chloro-3-nitroanilino)-2-cyano-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 108815414 |
| Molecular Formula | C17H18ClN5O4 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | (Z)-3-(4-chloro-3-nitroanilino)-2-cyano-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(Cl)c([N+](=O)[O-])c1)C(=O)NCCCN1CCCC1=O |
| InChI | InChI=1S/C17H18ClN5O4/c18-14-5-4-13(9-15(14)23(26)27)21-11-12(10-19)17(25)20-6-2-8-22-7-1-3-16(22)24/h4-5,9,11,21H,1-3,6-8H2,(H,20,25)/b12-11- |
| InChIKey | JNPZDEKUFRWAJD-QXMHVHEDSA-N |
| XLogP | 2.20 |
| TPSA | 128.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|